Cyclopentanecarboxylic acid, 1-[[(phenylmethoxy)carbonyl]amino]- (9CI) - Names and Identifiers
Name | Cbz-1-Amino-1-Cyclopentanecarboxylic Acid
|
Synonyms | Z-CLE-OH Z-Cle-Oh Z-NH(1)CPEN-OH Z-Nh(1)Cpen-Oh Cbz-Cyclolencine RARECHEM AL CF 0201 Rarechem Al Cf 0201 N-Alpha-Carbobenzoxy-Cycloleucine N-ALPHA-CARBOBENZOXY-CYCLOLEUCINE CBZ-1-AMINO-1-CYCLOPENTANECARBOXYLIC ACID Cbz-1-Amino-1-Cyclopentanecarboxylic Acid N-ALPHA-CARBOBENZOXY-1-AMINOCYCLOPENTANECARBOXYLIC ACID N-Alpha-Carbobenzoxy-1-Aminocyclopentanecarboxylic Acid 1-{[(benzyloxy)carbonyl]amino}cyclopentanecarboxylic acid Cyclopentanecarboxylic acid, 1-[[(phenylmethoxy)carbonyl]amino]- (9CI) Cyclopentanecarboxylic Acid, 1-[[(Phenylmethoxy)Carbonyl]Amino]- (9ci)
|
CAS | 17191-44-5
|
InChI | InChI=1/C14H17NO4/c16-12(17)14(8-4-5-9-14)15-13(18)19-10-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10H2,(H,15,18)(H,16,17) |
Cyclopentanecarboxylic acid, 1-[[(phenylmethoxy)carbonyl]amino]- (9CI) - Physico-chemical Properties
Molecular Formula | C14H17NO4
|
Molar Mass | 263.29 |
Density | 1.26g/cm3 |
Boling Point | 468.2°C at 760 mmHg |
Flash Point | 237°C |
Vapor Presure | 1.43E-09mmHg at 25°C |
Appearance | White powder |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.575 |
MDL | MFCD02094399 |
Cyclopentanecarboxylic acid, 1-[[(phenylmethoxy)carbonyl]amino]- (9CI) - Introduction
Cbz-1-Amino-1-Cyclopentanecarboxylic Acid(N-Boc-1-aminocyclopentanecarboxylic acid) is an organic compound. Its molecular formula is C12H19NO3 and its molecular weight is 225.29g/mol. The following is a description of some information about the properties, uses, preparation and safety of the compound:
Nature:
1. Appearance: Cbz-1-Amino-1-Cyclopentanecarboxylic Acid is white crystal or crystalline powder.
2. Melting point: Its melting point range is usually between 80-90 degrees Celsius.
3. Solubility: The compound can be dissolved in common organic solvents, such as ethyl acetate and methanol.
Use:
Cbz-1-Amino-1-Cyclopentanecarboxylic Acid is often used as an intermediate in organic synthesis. Among them, the Boc Group can protect the amino group in the reaction to prevent possible unnecessary reaction. The compounds can be used in the synthesis of amino acids and peptides, as well as in the synthesis of other organic compounds.
Method:
Cbz-1-Amino-1-Cyclopentanecarboxylic Acid can be synthesized by the following steps:
1. Cyclopentanone is reacted with alcohol and dimethyl sulfoxide to prepare cyclopentanol.
2. The reaction of cyclopentanol with chloroformic acid and cuprous bromide to generate the corresponding cyclopentyl formate.
3. Reacting cyclopentyl formate with sodium hydroxide and ethyl chloroformate to generate Cbz-1-Amino-1-Cyclopentanecarboxylic Acid.
Safety Information:
1. Cbz-1-Amino-1-Cyclopentanecarboxylic Acid is a chemical and should be operated in a specialized chemical laboratory.
2. Wear appropriate personal protective equipment, such as lab gloves and goggles, to avoid contact with the compound.
3. Pay attention to avoid inhaling the dust or vapor of the compound, and avoid contact with skin and eyes.
4. Store the compound in a dry, cool place, and store separately from the oxidizing agent and strong acid.
5. Please refer to the safety data sheet (SDS) of the chemical for more detailed safety information.
Last Update:2024-04-10 22:29:15